cas: 180675-08-5 — see every product listed under this CAS number, including other names
Fmoc-Asp(OMpe)-OH 97% (CAS 180675-08-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A258094-500g |
| cas | 180675-08-5 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 19199.44 Pln | |
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Ambeed | 10g | 654.06 Pln | |
| Ambeed | 25g | 1532.94 Pln | |
| Ambeed | 100g | 4853.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A258094 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid (CAS 180675-08-5) is a chemical compound with the molecular formula C25H29NO6 and a molecular weight of 439.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid. InChIKey: SYGKUYKLHYQKPL-NRFANRHFSA-N.
| Molecular formula | C25H29NO6 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid |
| InChIKey | SYGKUYKLHYQKPL-NRFANRHFSA-N |
| SMILES | CCC(C)(CC)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)