cas: 312965-04-1 — see every product listed under this CAS number, including other names
Fmoc-COP 96% (CAS 312965-04-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A614855-250mg |
| cas | 312965-04-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1788.81 Pln | |
| Ambeed | 10g | 3357.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A614855 |
4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid (CAS 312965-04-1) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid. InChIKey: TUZVFPRISNDQLQ-UHFFFAOYSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid |
| InChIKey | TUZVFPRISNDQLQ-UHFFFAOYSA-N |
| SMILES | C1COC(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)