cas: 180576-05-0 — see every product listed under this CAS number, including other names
Fmoc-Cmpi-OH 96% (CAS 180576-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A542087-250mg |
| cas | 180576-05-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1104.63 Pln | |
| Ambeed | 25g | 4058.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A542087 |
2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid (CAS 180576-05-0) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid. InChIKey: XNWPGFGLHGFRRP-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid |
| InChIKey | XNWPGFGLHGFRRP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)