cas: 332064-94-5 — see every product listed under this CAS number, including other names
Fmoc-D-β-homopropargylglycine 95% (CAS 332064-94-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A243085-100mg |
| cas | 332064-94-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1510.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A243085 |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-ynoic acid (CAS 332064-94-5) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-ynoic acid. InChIKey: ALHPEVGGGAQSCG-CQSZACIVSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-ynoic acid |
| InChIKey | ALHPEVGGGAQSCG-CQSZACIVSA-N |
| SMILES | C#CC[C@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)