cas: 142994-45-4 — see every product listed under this CAS number, including other names
Fmoc-D-3-Pal-OH 99% (CAS 142994-45-4) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A149266-500g |
| cas | 142994-45-4 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 26486.31 Pln | |
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 481.62 Pln | |
| Ambeed | 25g | 2133.69 Pln | |
| Ambeed | 100g | 6672.69 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A149266 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid (CAS 142994-45-4) is a chemical compound with the molecular formula C23H20N2O4 and a molecular weight of 388.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid. InChIKey: JQLPMTXRCLXOJO-OAQYLSRUSA-N.
| Molecular formula | C23H20N2O4 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid |
| InChIKey | JQLPMTXRCLXOJO-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CN=CC=C4)C(=O)O |
Computed by PubChem (NCBI)