cas: 92122-45-7 — see every product listed under this CAS number, including other names
Fmoc-D-Lys(Boc)-OH, 99.94% (CAS 92122-45-7) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 100 g, 25 g, 5 g, 10mM/1mL, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007655-10 g |
| cas | 92122-45-7 |
| size | 10 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 305.76 Pln | |
| MedChemExpress | 100 g | 969.85 Pln | |
| MedChemExpress | 25 g | 496.16 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 50 g | 686.57 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.94% |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 92122-45-7) is a chemical compound with the molecular formula C26H32N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: UMRUUWFGLGNQLI-JOCHJYFZSA-N.
| Molecular formula | C26H32N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | UMRUUWFGLGNQLI-JOCHJYFZSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)