Fmoc-D-Nip-OH 97%
cas: 193693-67-3 — see every product listed under this CAS number, including other names
Fmoc-D-Nip-OH 97% (CAS 193693-67-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128982-100mg |
| cas | 193693-67-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 10g | 2267.19 Pln | |
| Ambeed | 25g | 4469.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A128982 |
(3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid (CAS 193693-67-3) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid. InChIKey: FINXGQXNIBNREL-CQSZACIVSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
| InChIKey | FINXGQXNIBNREL-CQSZACIVSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidine-3-carboxylic acid, (r)-1-fmoc-piperidine-3-carboxylic acid, (R)-1-(((9H-fluoren-9-yl)methoxy)carbonyl)piperidine-3-carboxylic acid, D-1-Fmoc-Nipecotic acid, (R)-Fmoc-Nip-OH, fmoc-(r)-nipecotic acid, (3R)-1-Fmoc-3-piperidinecarboxylic acid, (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid, FMOC-D-NIP-OH, fmoc-d-nipc-oh