cas: 214852-45-6 — see every product listed under this CAS number, including other names
Fmoc-D-cis-Hyp-OH, 95%, 95% (CAS 214852-45-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11826X-25g |
| cas | 214852-45-6 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1101.20 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 491.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 214852-45-6) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: GOUUPUICWUFXPM-KZULUSFZSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | GOUUPUICWUFXPM-KZULUSFZSA-N |
| SMILES | C1[C@H](CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)