cas: 214852-45-6 — see every product listed under this CAS number, including other names
FMOC-D-CIS-HYP-OH, 95% (CAS 214852-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F475421-1G |
| cas | 214852-45-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 575.86 Pln | |
| Fluorochem | 25g | 1356.83 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 214852-45-6) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: GOUUPUICWUFXPM-KZULUSFZSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | GOUUPUICWUFXPM-KZULUSFZSA-N |
| SMILES | C1[C@H](CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)