cas: 1219163-22-0 — see every product listed under this CAS number, including other names
Fmoc-DL-Ala(cPr)-OH 97% (CAS 1219163-22-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A981954-50mg |
| cas | 1219163-22-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 186.81 Pln | |
| Ambeed | 100mg | 236.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A981954 |
3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1219163-22-0) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: DRGUEWQZLABTFG-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | DRGUEWQZLABTFG-UHFFFAOYSA-N |
| SMILES | C1CC1CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)