CAS 214750-76-2 appears in our catalog under these names: Fmoc-L-cyclopropylalanine, >95% (HPLC), Fmoc–β–cyclopropyl–Ala–OH, Fmoc-L-Cpa-OH, Fmoc-β-cyclopropyl-L-Alanine 95%, Fmoc-β-cyclopropyl-L-Alanine, 95%, 95%. Offered by: TRC, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 5 g.
(2S)-3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 214750-76-2) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: DRGUEWQZLABTFG-IBGZPJMESA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | DRGUEWQZLABTFG-IBGZPJMESA-N |
| SMILES | C1CC1C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)