cas: 158922-07-7 — see every product listed under this CAS number, including other names
Fmoc-DL-Nip-OH 97% (CAS 158922-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A216420-1g |
| cas | 158922-07-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 25g | 542.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A216420 |
1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid (CAS 158922-07-7) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid. InChIKey: FINXGQXNIBNREL-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
| InChIKey | FINXGQXNIBNREL-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)