cas: 133464-46-7 — see every product listed under this CAS number, including other names
Fmoc-Glu(OAll)-OH 98% (CAS 133464-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115243-250mg |
| cas | 133464-46-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 459.38 Pln | |
| Ambeed | 100g | 1616.38 Pln | |
| Ambeed | 500g | 7790.75 Pln | |
| Ambeed | 1000g | 13197.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A115243 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid (CAS 133464-46-7) is a chemical compound with the molecular formula C23H23NO6 and a molecular weight of 409.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid. InChIKey: LRBARFFNYOKIAX-FQEVSTJZSA-N.
| Molecular formula | C23H23NO6 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid |
| InChIKey | LRBARFFNYOKIAX-FQEVSTJZSA-N |
| SMILES | C=CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)