cas: 133464-46-7 — see every product listed under this CAS number, including other names
Fmoc-Glu(OAll)-OH, 98%, 98% (CAS 133464-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QNC-250mg |
| cas | 133464-46-7 |
| size | 250mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 342.80 Pln | |
| Chemat | 100g | 1163.60 Pln | |
| Chemat | 50g | 616.40 Pln | |
| Chemat | 250g | 2680.40 Pln | |
| Chemat | 1kg | 6448.40 Pln | |
| Chemat | 5kg | 31478.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid (CAS 133464-46-7) is a chemical compound with the molecular formula C23H23NO6 and a molecular weight of 409.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid. InChIKey: LRBARFFNYOKIAX-FQEVSTJZSA-N.
| Molecular formula | C23H23NO6 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid |
| InChIKey | LRBARFFNYOKIAX-FQEVSTJZSA-N |
| SMILES | C=CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)