cas: 163437-14-7 — see every product listed under this CAS number, including other names
Fmoc-Met(O2)-OH 95% (CAS 163437-14-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123943-500g |
| cas | 163437-14-7 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 7612.75 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 642.94 Pln | |
| Ambeed | 100g | 1955.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A123943 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid (CAS 163437-14-7) is a chemical compound with the molecular formula C20H21NO6S and a molecular weight of 403.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid. InChIKey: KJLKPACOHZKRFM-SFHVURJKSA-N.
| Molecular formula | C20H21NO6S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid |
| InChIKey | KJLKPACOHZKRFM-SFHVURJKSA-N |
| SMILES | CS(=O)(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)