cas: 71989-28-1 — see every product listed under this CAS number, including other names
Fmoc-Met-OH, 98% (CAS 71989-28-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | M03368-25G |
| cas | 71989-28-1 |
| size | 25g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 100g | 195.78 Pln | |
| Fluorochem | 500g | 555.03 Pln | |
| Fluorochem | 1kg | 1023.62 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 225.75 Pln | |
| Ambeed | 500g | 553.94 Pln | |
| Ambeed | 1kg | 1026.75 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoic acid (CAS 71989-28-1) is a chemical compound with the molecular formula C20H21NO4S and a molecular weight of 371.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoic acid. InChIKey: BUBGAUHBELNDEW-SFHVURJKSA-N.
| Molecular formula | C20H21NO4S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoic acid |
| InChIKey | BUBGAUHBELNDEW-SFHVURJKSA-N |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)