cas: 944797-51-7 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Cys(Trt)-OH 98% (CAS 944797-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A216450-100mg |
| cas | 944797-51-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 25g | 4102.81 Pln | |
| Ambeed | 100g | 12975.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A216450 |
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid (CAS 944797-51-7) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid. InChIKey: RAKOPMQMPUNRGI-DHUJRADRSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid |
| InChIKey | RAKOPMQMPUNRGI-DHUJRADRSA-N |
| SMILES | CN([C@@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)