FMoc-N-Me-Cys(Trt)-OH, 98%, 98%
cas: 944797-51-7 — see every product listed under this CAS number, including other names
FMoc-N-Me-Cys(Trt)-OH, 98%, 98% (CAS 944797-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMQ6-100mg |
| cas | 944797-51-7 |
| size | 100mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 50g | 2267.60 Pln | |
| Chemat | 100g | 4197.20 Pln | |
| Chemat | 250g | 6698.00 Pln | |
| Chemat | 500g | 12676.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid (CAS 944797-51-7) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid. InChIKey: RAKOPMQMPUNRGI-DHUJRADRSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid |
| InChIKey | RAKOPMQMPUNRGI-DHUJRADRSA-N |
| SMILES | CN([C@@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-N-Me-Cys(Trt)-OH, Fmoc-N-Me-L-Cys(Trt)-OH, Fmoc-MeCys(Trt)-OH, N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-S-trityl-L-cysteine, Fmoc-N-Methyl-l-cysteine(trt), N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-S-(triphenylmethyl)-L-cysteine, Fmoc-N-methyl-L-Cysteine(Trityl), N-Fmoc-N-methyl-S-trityl-L-cysteine, (R)-2-[Fmoc(methyl)amino]-3-(tritylthio)propanoic Acid