cas: 560088-66-6 — see every product listed under this CAS number, including other names
Fmoc-PEG3-alcohol 97% (CAS 560088-66-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A314574-100mg |
| cas | 560088-66-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A314574 |
9H-fluoren-9-ylmethyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate (CAS 560088-66-6) is a chemical compound with the molecular formula C21H25NO5 and a molecular weight of 371.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate. InChIKey: OKWGKDNHZKUFBX-UHFFFAOYSA-N.
| Molecular formula | C21H25NO5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate |
| InChIKey | OKWGKDNHZKUFBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCO |
Computed by PubChem (NCBI)