CAS 560088-66-6 appears in our catalog under these names: [2-[2-(2-Hydroxy-ethoxy)-ethoxy]-ethyl]-carbamic acid 9h-fluoren-9-ylmethyl ester, 95%, Fmoc-AEEE, Fmoc-PEG3-alcohol 97%, (9H-Fluoren-9-yl)methyl (2-(2-(2-hydroxyethoxy)ethoxy)ethyl)carbamate, 97%, 97%, Fmoc-PEG3-alcohol, 98.0%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 25g, 500mg, 100mg, 100 mg, 5 g.
9H-fluoren-9-ylmethyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate (CAS 560088-66-6) is a chemical compound with the molecular formula C21H25NO5 and a molecular weight of 371.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate. InChIKey: OKWGKDNHZKUFBX-UHFFFAOYSA-N.
| Molecular formula | C21H25NO5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate |
| InChIKey | OKWGKDNHZKUFBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCO |
Computed by PubChem (NCBI)