Products 129439-63-0
CAS 129439-63-0 is the registry number for Phenylmethyl (2r)-2-[(tert-butoxy)carbonylamino]-3-(4-hydroxyphenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl (2R)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 129439-63-0) is a chemical compound with the molecular formula C21H25NO5 and a molecular weight of 371.4 g/mol. IUPAC name: benzyl (2R)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: HZDNRJRGRZEVCM-GOSISDBHSA-N.
| Molecular formula | C21H25NO5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | benzyl (2R)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | HZDNRJRGRZEVCM-GOSISDBHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)