CAS 16881-33-7 appears in our catalog under these names: Z–Tyr–OtBu, Z-Tyr-OtBu 97%, Z-Tyr-OtBu, 97%, 97%, Z-Tyr-OtBu, 99.89%, Z-TYR-OTBU H2O, 97%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 250mg, 25 g, 10 g.
Tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 16881-33-7) is a chemical compound with the molecular formula C21H25NO5 and a molecular weight of 371.4 g/mol. IUPAC name: tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: ZRMZOLWSSDIXDQ-SFHVURJKSA-N.
| Molecular formula | C21H25NO5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | ZRMZOLWSSDIXDQ-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)