cas: 198561-04-5 — see every product listed under this CAS number, including other names
Fmoc-Phe(4-Br)-OH 97% (CAS 198561-04-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142027-500g |
| cas | 198561-04-5 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 6839.56 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 242.44 Pln | |
| Ambeed | 25g | 492.75 Pln | |
| Ambeed | 100g | 1761.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142027 |
(2S)-3-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 198561-04-5) is a chemical compound with the molecular formula C24H20BrNO4 and a molecular weight of 466.3 g/mol. IUPAC name: (2S)-3-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: TVBAVBWXRDHONF-QFIPXVFZSA-N.
| Molecular formula | C24H20BrNO4 |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | (2S)-3-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | TVBAVBWXRDHONF-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)Br)C(=O)O |
Computed by PubChem (NCBI)