cas: 204716-17-6 — see every product listed under this CAS number, including other names
Fmoc-Phe(4-CONH2)-OH, 97% (CAS 204716-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616745-100MG |
| cas | 204716-17-6 |
| size | 100mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 500mg | 299.91 Pln | |
| Fluorochem | 1g | 367.60 Pln | |
| Fluorochem | 2.5g | 830.98 Pln | |
| Fluorochem | 5g | 1388.07 Pln | |
| Fluorochem | 10g | 2231.52 Pln | |
| Fluorochem | 25g | 4803.53 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-3-(4-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 204716-17-6) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2S)-3-(4-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MUNGLNMRFZUOTD-QFIPXVFZSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2S)-3-(4-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | MUNGLNMRFZUOTD-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)