cas: 35737-10-1 — see every product listed under this CAS number, including other names
Fmoc-beta-Alanine, 98%, 98% (CAS 35737-10-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 250g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145Y0-5g |
| cas | 35737-10-1 |
| size | 5g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 174.80 Pln | |
| Chemat | 250g | 342.80 Pln | |
| Chemat | 500g | 686.40 Pln | |
| Chemat | 1kg | 1259.60 Pln | |
| Chemat | 5kg | 4156.80 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 35737-10-1) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: LINBWYYLPWJQHE-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | LINBWYYLPWJQHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC(=O)O |
Computed by PubChem (NCBI)