Products 1048350-30-6

CAS 1048350-30-6 is the registry number for 2-(5-(Benzyloxy)-6-methoxy-1h-indol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(6-methoxy-5-phenylmethoxy-1H-indol-3-yl)acetic acid (CAS 1048350-30-6) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 2-(6-methoxy-5-phenylmethoxy-1H-indol-3-yl)acetic acid. InChIKey: YDKSAJOYQSQHAU-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17NO4
Molecular weight311.3 g/mol
IUPAC name2-(6-methoxy-5-phenylmethoxy-1H-indol-3-yl)acetic acid
InChIKeyYDKSAJOYQSQHAU-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)NC=C2CC(=O)O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)