Fmoc-hyp(bzl)-oh, 98%
cas: 174800-02-3 — see every product listed under this CAS number, including other names
Fmoc-hyp(bzl)-oh, 98% (CAS 174800-02-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 100g, 100mg, 250mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | SS-0313-1g |
| cas | 174800-02-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1699.81 Pln | |
| Ambeed | 100g | 5287.62 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 381.20 Pln | |
| Chemat | 10g | 678.80 Pln | |
| Chemat | 25g | 1163.60 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 464.31 Pln | |
| BLDpharm | 25g | 1824.94 Pln | |
| BLDpharm | 100g | 5695.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylmethoxypyrrolidine-2-carboxylic acid (CAS 174800-02-3) is a chemical compound with the molecular formula C27H25NO5 and a molecular weight of 443.5 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylmethoxypyrrolidine-2-carboxylic acid. InChIKey: XGFMHBUVVWZBFT-CLOONOSVSA-N.
| Molecular formula | C27H25NO5 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylmethoxypyrrolidine-2-carboxylic acid |
| InChIKey | XGFMHBUVVWZBFT-CLOONOSVSA-N |
| SMILES | C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)
