CAS 439290-35-4 is the registry number for (2S,4S)-1-((9H-Fluoren-9-yl)methyl) 2-benzyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-O-benzyl 1-O-(9H-fluoren-9-ylmethyl) (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 439290-35-4) is a chemical compound with the molecular formula C27H25NO5 and a molecular weight of 443.5 g/mol. IUPAC name: 2-O-benzyl 1-O-(9H-fluoren-9-ylmethyl) (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: CVHUWFLTKKZKSQ-DFBJGRDBSA-N.
| Molecular formula | C27H25NO5 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | 2-O-benzyl 1-O-(9H-fluoren-9-ylmethyl) (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | CVHUWFLTKKZKSQ-DFBJGRDBSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C(=O)OCC2=CC=CC=C2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)O |
Computed by PubChem (NCBI)