Products 2484872-49-1

CAS 2484872-49-1 is the registry number for Aldol&reg, 470 butyrate, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] butanoate (CAS 2484872-49-1) is a chemical compound with the molecular formula C27H25NO5 and a molecular weight of 443.5 g/mol. IUPAC name: [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] butanoate. InChIKey: OTNSJAMGHWALRS-UHFFFAOYSA-N.

Identity
Molecular formulaC27H25NO5
Molecular weight443.5 g/mol
IUPAC name[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] butanoate
InChIKeyOTNSJAMGHWALRS-UHFFFAOYSA-N
SMILESCCCC(=O)OC1=CN(C2=CC=CC=C21)C3=CC=CC=C3C(=O)C4=C(C=C(C=C4)OC)OC

Computed by PubChem (NCBI)