CAS 1334671-64-5 is the registry number for Fmoc-L-cis-Hyp(Bzl)-OH. Offered by: Iris Biotech. Available pack sizes: 500mg, 1g, 5g.
(2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylmethoxypyrrolidine-2-carboxylic acid (CAS 1334671-64-5) is a chemical compound with the molecular formula C27H25NO5 and a molecular weight of 443.5 g/mol. IUPAC name: (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylmethoxypyrrolidine-2-carboxylic acid. InChIKey: XGFMHBUVVWZBFT-DFBJGRDBSA-N.
| Molecular formula | C27H25NO5 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylmethoxypyrrolidine-2-carboxylic acid |
| InChIKey | XGFMHBUVVWZBFT-DFBJGRDBSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)