CAS 67700-30-5 appears in our catalog under these names: Furaprofen (R803), Furaprofen, 98%, Furaprofen/ 99.49% (existing batch purity), Furaprofen, Furaprofen, 99.78%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 1 mg, 10mM/1mL.
2-(3-phenyl-1-benzofuran-7-yl)propanoic acid (CAS 67700-30-5) is a chemical compound with the molecular formula C17H14O3 and a molecular weight of 266.29 g/mol. IUPAC name: 2-(3-phenyl-1-benzofuran-7-yl)propanoic acid. InChIKey: ODZUWQAFWMLWCF-UHFFFAOYSA-N.
| Molecular formula | C17H14O3 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 2-(3-phenyl-1-benzofuran-7-yl)propanoic acid |
| InChIKey | ODZUWQAFWMLWCF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=C1OC=C2C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)