CAS 2088410-46-0 appears in our catalog under these names: GSK620, GSK620/ 99.42% (existing batch purity), 1-Benzyl-N5-cyclopropyl-N3-methyl-2-oxo-1,2-dihydropyridine-3,5-dicarboxamide, GSK620 97%, GSK620, 99.88% ,, 99.88% ,. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg, 200mg.
1-benzyl-5-N-cyclopropyl-3-N-methyl-2-oxopyridine-3,5-dicarboxamide (CAS 2088410-46-0) is a chemical compound with the molecular formula C18H19N3O3 and a molecular weight of 325.4 g/mol. IUPAC name: 1-benzyl-5-N-cyclopropyl-3-N-methyl-2-oxopyridine-3,5-dicarboxamide. InChIKey: QZZCUOVXHPAQRQ-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 1-benzyl-5-N-cyclopropyl-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
| InChIKey | QZZCUOVXHPAQRQ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CN(C1=O)CC2=CC=CC=C2)C(=O)NC3CC3 |
Computed by PubChem (NCBI)