cas: 593-85-1 — see every product listed under this CAS number, including other names
Guanidine Carbonate, >98.0%(T) (CAS 593-85-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | G0161-25G |
| cas | 593-85-1 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 98.68 Pln | |
| TCI | 500g | 211.77 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Carbonic acid;bis(guanidine) (CAS 593-85-1) is a chemical compound with the molecular formula C3H12N6O3 and a molecular weight of 180.17 g/mol. IUPAC name: carbonic acid;bis(guanidine). InChIKey: STIAPHVBRDNOAJ-UHFFFAOYSA-N.
| Molecular formula | C3H12N6O3 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | carbonic acid;bis(guanidine) |
| InChIKey | STIAPHVBRDNOAJ-UHFFFAOYSA-N |
| SMILES | C(=N)(N)N.C(=N)(N)N.C(=O)(O)O |
Computed by PubChem (NCBI)