CAS 593-85-1 appears in our catalog under these names: Guanidine carbonate, 95%, Guanidine Carbonate, Guanidine carbonate, 98% , Guanidine carbonate, 98.50%, Guanidine carbonate, 99+%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 100g, 1kg, 500g, 5g, 25g, 1g, 1000g, 5000g.
Carbonic acid;bis(guanidine) (CAS 593-85-1) is a chemical compound with the molecular formula C3H12N6O3 and a molecular weight of 180.17 g/mol. IUPAC name: carbonic acid;bis(guanidine). InChIKey: STIAPHVBRDNOAJ-UHFFFAOYSA-N.
| Molecular formula | C3H12N6O3 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | carbonic acid;bis(guanidine) |
| InChIKey | STIAPHVBRDNOAJ-UHFFFAOYSA-N |
| SMILES | C(=N)(N)N.C(=N)(N)N.C(=O)(O)O |
Computed by PubChem (NCBI)