cas: 593-85-1 — see every product listed under this CAS number, including other names
Guanidine carbonate, 98.50% (CAS 593-85-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM70250E-100g |
| cas | 593-85-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 141.71 Pln | |
| Chemat | 500g | 257.91 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.50% |
| category | Chemicals |
Carbonic acid;bis(guanidine) (CAS 593-85-1) is a chemical compound with the molecular formula C3H12N6O3 and a molecular weight of 180.17 g/mol. IUPAC name: carbonic acid;bis(guanidine). InChIKey: STIAPHVBRDNOAJ-UHFFFAOYSA-N.
| Molecular formula | C3H12N6O3 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | carbonic acid;bis(guanidine) |
| InChIKey | STIAPHVBRDNOAJ-UHFFFAOYSA-N |
| SMILES | C(=N)(N)N.C(=N)(N)N.C(=O)(O)O |
Computed by PubChem (NCBI)