cas: 593-85-1 — see every product listed under this CAS number, including other names
Guanidine carbonate, 99+% (CAS 593-85-1) is a chemical reagent available from Chemat. Available pack sizes: 1KG, 5KG, 250g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 120220010 |
| cas | 593-85-1 |
| size | 1KG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1KG | 342.10 Pln | |
| Thermo Scientific (Acros) | 5KG | 1541.24 Pln | |
| Thermo Scientific (Acros) | 250g | 127.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99+% |
Carbonic acid;bis(guanidine) (CAS 593-85-1) is a chemical compound with the molecular formula C3H12N6O3 and a molecular weight of 180.17 g/mol. IUPAC name: carbonic acid;bis(guanidine). InChIKey: STIAPHVBRDNOAJ-UHFFFAOYSA-N.
| Molecular formula | C3H12N6O3 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | carbonic acid;bis(guanidine) |
| InChIKey | STIAPHVBRDNOAJ-UHFFFAOYSA-N |
| SMILES | C(=N)(N)N.C(=N)(N)N.C(=O)(O)O |
Computed by PubChem (NCBI)