cas: 1956436-56-8 — see every product listed under this CAS number, including other names
H-β-Lys(Boc)-OH 95% (CAS 1956436-56-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160820-100mg |
| cas | 1956436-56-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 1660.88 Pln | |
| Ambeed | 5g | 4853.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A160820 |
(3S)-3-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1956436-56-8) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: (3S)-3-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: QLDUAIKSZTULGY-QMMMGPOBSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (3S)-3-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | QLDUAIKSZTULGY-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)