H-Ala-Leu-OH, 98%
cas: 3303-34-2 — see every product listed under this CAS number, including other names
H-Ala-Leu-OH, 98% (CAS 3303-34-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 5mg, 10mg, 50mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A198938-100mg |
| cas | 3303-34-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 982.25 Pln | |
| Chemat | 5mg | 88.40 Pln | |
| Chemat | 10mg | 93.20 Pln | |
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 630.80 Pln | |
| BLDpharm | 50mg | 181.07 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 1052.99 Pln | |
| BLDpharm | 10g | 1647.22 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Ala-Leu is a dipeptide formed from L-alanyl and L-leucine residues. It has a role as a metabolite. It is a tautomer of an Ala-Leu zwitterion.
Source: ChEBI
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid |
| InChIKey | RDIKFPRVLJLMER-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
l-alanyl-l-leucine, Ala-Leu, N-L-Alanyl-L-leucine, (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid, (2S)-2-(((2S)-2-aminopropanoyl)amino)-4-methylpentanoic acid, (2S)-2-(((2S)-2-azaniumylpropanoyl)amino)-4-methylpentanoate, H-Ala-Leu-OH, alanylleucine, alanyl-leucine, alanyl-DL-leucine
