cas: 3303-34-2 — see every product listed under this CAS number, including other names
L-Alanyl-L-leucine, 98% (CAS 3303-34-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791712-100MG |
| cas | 3303-34-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 2.5g | 643.54 Pln | |
| Fluorochem | 5g | 955.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ala-Leu is a dipeptide formed from L-alanyl and L-leucine residues. It has a role as a metabolite. It is a tautomer of an Ala-Leu zwitterion.
Source: ChEBI
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid |
| InChIKey | RDIKFPRVLJLMER-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N |
Computed by PubChem (NCBI)