cas: 133628-73-6 — see every product listed under this CAS number, including other names
H-Asp(AMC)-OH, 98%, 98% (CAS 133628-73-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1191C7-10mg |
| cas | 133628-73-6 |
| size | 10mg |
| availability | 0.03g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 1442.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid (CAS 133628-73-6) is a chemical compound with the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. IUPAC name: (2S)-2-amino-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid. InChIKey: ARZPQBJTLVVDNP-JTQLQIEISA-N.
| Molecular formula | C14H14N2O5 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | (2S)-2-amino-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid |
| InChIKey | ARZPQBJTLVVDNP-JTQLQIEISA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)