CAS 914349-06-7 is the registry number for 1-Boc-3-formyl-5-nitroindole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Tert-butyl 3-formyl-5-nitroindole-1-carboxylate (CAS 914349-06-7) is a chemical compound with the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. IUPAC name: tert-butyl 3-formyl-5-nitroindole-1-carboxylate. InChIKey: CGVAPQUBCFFZMC-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O5 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | tert-butyl 3-formyl-5-nitroindole-1-carboxylate |
| InChIKey | CGVAPQUBCFFZMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)