CAS 219138-13-3 appears in our catalog under these names: H-Asp-AMC, H–Asp–AMC. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 1g, 25mg, 100mg, 500mg.
(3S)-3-amino-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid (CAS 219138-13-3) is a chemical compound with the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. IUPAC name: (3S)-3-amino-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid. InChIKey: AAGPGZSFBVEQMU-JTQLQIEISA-N.
| Molecular formula | C14H14N2O5 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | (3S)-3-amino-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid |
| InChIKey | AAGPGZSFBVEQMU-JTQLQIEISA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)