Products 1058740-09-2
CAS 1058740-09-2 appears in our catalog under these names: 1-tert-Butyl 3-methyl 5-nitro-1h-indole-1,3-dicarboxylate, 95%, tert-Butyl 3-formyl-6-nitro-1H-indole-1-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 3-formyl-6-nitroindole-1-carboxylate (CAS 1058740-09-2) is a chemical compound with the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. IUPAC name: tert-butyl 3-formyl-6-nitroindole-1-carboxylate. InChIKey: OXTQFXZJBWGZOL-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O5 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | tert-butyl 3-formyl-6-nitroindole-1-carboxylate |
| InChIKey | OXTQFXZJBWGZOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)