H-Chg-OMe.HCl, 95%
cas: 14328-63-3 — see every product listed under this CAS number, including other names
H-Chg-OMe.HCl, 95% (CAS 14328-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch110ADZ-250mg |
| cas | 14328-63-3 |
| size | 250mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 338.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 203.29 Pln | |
| BLDpharm | 100g | 464.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride (CAS 14328-63-3) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride. InChIKey: ORJOGDRCFDWIIJ-QRPNPIFTSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride |
| InChIKey | ORJOGDRCFDWIIJ-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1CCCCC1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Chg-OMe.HCl, H-CHG-OME HCL, (S)-Methyl 2-amino-2-cyclohexylacetate hydrochloride, H-Chg-OMe hydrochloride, Methyl (S)-2-Amino-2-cyclohexylacetate Hydrochloride, H-Chg-OMe inverted exclamation mark currencyHCl, methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride, L-cyclohexylglycine methylester hydrochloride, methyl(2s)-amino(cyclohexyl)ethanoate hydrochloride, L-Cyclohexylglycine methyl ester hydrochloride