Products 14328-63-3
CAS 14328-63-3 appears in our catalog under these names: H-Chg-OMe hydrochloride, 97%, H–Chg–OMe·HCl, H-Chg-OMe hydrochloride, H-Chg-OMe·HCl 95%, H-Chg-OMe.HCl, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1g, 500g, 5g, 10g, 50g, 250g.
Methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride (CAS 14328-63-3) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride. InChIKey: ORJOGDRCFDWIIJ-QRPNPIFTSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride |
| InChIKey | ORJOGDRCFDWIIJ-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1CCCCC1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Chg-OMe.HCl, H-CHG-OME HCL, (S)-Methyl 2-amino-2-cyclohexylacetate hydrochloride, H-Chg-OMe hydrochloride, Methyl (S)-2-Amino-2-cyclohexylacetate Hydrochloride, H-Chg-OMe inverted exclamation mark currencyHCl, methyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride, L-cyclohexylglycine methylester hydrochloride, methyl(2s)-amino(cyclohexyl)ethanoate hydrochloride, L-Cyclohexylglycine methyl ester hydrochloride