CAS 14328-64-4 appears in our catalog under these names: Methyl (2R)–2–amino–2–cyclohexylethanoate hydrochloride, (R)-Methyl 2-amino-2-cyclohexylacetate hydrochloride, 95%, 95%, Methyl (2R)-2-amino-2-cyclohexylethanoate hydrochloride, 98.0%, (R)-Methyl 2-amino-2-cyclohexylacetate hydrochloride, 98%, H-D-Chg-OMe·HCl, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 25g, 1g, 5g, 25 g, 100 g, 5 g.
Methyl (2R)-2-amino-2-cyclohexylacetate;hydrochloride (CAS 14328-64-4) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl (2R)-2-amino-2-cyclohexylacetate;hydrochloride. InChIKey: ORJOGDRCFDWIIJ-DDWIOCJRSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-cyclohexylacetate;hydrochloride |
| InChIKey | ORJOGDRCFDWIIJ-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1CCCCC1)N.Cl |
Computed by PubChem (NCBI)