cas: 213475-52-6 — see every product listed under this CAS number, including other names
H-Chg-OtBu.HCl, 97%, 97% (CAS 213475-52-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BG5C-1g |
| cas | 213475-52-6 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 333.20 Pln | |
| Chemat | 25g | 674.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride (CAS 213475-52-6) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: tert-butyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride. InChIKey: IAOLQNWJPAWXBA-PPHPATTJSA-N.
| Molecular formula | C12H24ClNO2 |
|---|---|
| Molecular weight | 249.78 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride |
| InChIKey | IAOLQNWJPAWXBA-PPHPATTJSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](C1CCCCC1)N.Cl |
Computed by PubChem (NCBI)