CAS 213475-52-6 appears in our catalog under these names: (S)–tert–Butyl 2–amino–2–cyclohexylacetate hydrochloride, H-Chg-OtBu·HCl 97%, H-Chg-OtBu.HCl, 97%, 97%, (S)-tert-Butyl 2-amino-2-cyclohexylacetate hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
Tert-butyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride (CAS 213475-52-6) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: tert-butyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride. InChIKey: IAOLQNWJPAWXBA-PPHPATTJSA-N.
| Molecular formula | C12H24ClNO2 |
|---|---|
| Molecular weight | 249.78 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-2-cyclohexylacetate;hydrochloride |
| InChIKey | IAOLQNWJPAWXBA-PPHPATTJSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](C1CCCCC1)N.Cl |
Computed by PubChem (NCBI)