Products 2203139-74-4

CAS 2203139-74-4 is the registry number for 3-(1-Isobutyl-piperidin-4-yl)-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 2g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[1-(2-methylpropyl)piperidin-4-yl]propanoic acid;hydrochloride (CAS 2203139-74-4) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: 3-[1-(2-methylpropyl)piperidin-4-yl]propanoic acid;hydrochloride. InChIKey: YIZQJSZURIEOLA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24ClNO2
Molecular weight249.78 g/mol
IUPAC name3-[1-(2-methylpropyl)piperidin-4-yl]propanoic acid;hydrochloride
InChIKeyYIZQJSZURIEOLA-UHFFFAOYSA-N
SMILESCC(C)CN1CCC(CC1)CCC(=O)O.Cl

Computed by PubChem (NCBI)