Products 1888498-82-5

CAS 1888498-82-5 is the registry number for tert-Butyl 2-amino-2-cyclohexylacetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-amino-2-cyclohexylacetate;hydrochloride (CAS 1888498-82-5) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: tert-butyl 2-amino-2-cyclohexylacetate;hydrochloride. InChIKey: IAOLQNWJPAWXBA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24ClNO2
Molecular weight249.78 g/mol
IUPAC nametert-butyl 2-amino-2-cyclohexylacetate;hydrochloride
InChIKeyIAOLQNWJPAWXBA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C(C1CCCCC1)N.Cl

Computed by PubChem (NCBI)